C17H17N3O3 — CID 20806885
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(3-hydroxyprop-1-ynyl)furo[3,2-c]pyridine-6-carboxamide (PubChem CID 20806885) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(3-hydroxyprop-1-ynyl)furo[3,2-c]pyridine-6-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(3-hydroxyprop-1-ynyl)furo[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 20806885 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(3-hydroxyprop-1-ynyl)furo[3,2-c]pyridine-6-carboxamide |
| SMILES | O=C(NC1CN2CC[C@H]1C2)c1cc2oc(C#CCO)cc2cn1 |
| InChI | InChI=1S/C17H17N3O3/c21-5-1-2-13-6-12-8-18-14(7-16(12)23-13)17(22)19-15-10-20-4-3-11(15)9-20/h6-8,11,15,21H,3-5,9-10H2,(H,19,22)/t11-,15?/m0/s1 |
| InChIKey | NIGGPXRBUXNSAW-VPHXOMNUSA-N |
| XLogP | 0.61 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|