C17H14F3N3O2 — CID 20806921
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(3,3,3-trifluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide (PubChem CID 20806921) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(3,3,3-trifluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(3,3,3-trifluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 20806921 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-(3,3,3-trifluoroprop-1-ynyl)furo[2,3-c]pyridine-5-carboxamide |
| SMILES | O=C(NC1CN2CC[C@H]1C2)c1cc2c(C#CC(F)(F)F)coc2cn1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-17(19,20)3-1-11-9-25-15-6-21-13(5-12(11)15)16(24)22-14-8-23-4-2-10(14)7-23/h5-6,9-10,14H,2,4,7-8H2,(H,22,24)/t10-,14?/m0/s1 |
| InChIKey | DNZODRCSPBPRIU-XLLULAGJSA-N |
| XLogP | 2.18 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|