C16H18N4O2S — CID 20806941
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-[formyl(methyl)amino]thieno[2,3-c]pyridine-5-carboxamide (PubChem CID 20806941) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-[formyl(methyl)amino]thieno[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-[formyl(methyl)amino]thieno[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 20806941 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-3-[formyl(methyl)amino]thieno[2,3-c]pyridine-5-carboxamide |
| SMILES | CN(C=O)c1csc2cnc(C(=O)NC3CN4CC[C@H]3C4)cc12 |
| InChI | InChI=1S/C16H18N4O2S/c1-19(9-21)14-8-23-15-5-17-12(4-11(14)15)16(22)18-13-7-20-3-2-10(13)6-20/h4-5,8-10,13H,2-3,6-7H2,1H3,(H,18,22)/t10-,13?/m0/s1 |
| InChIKey | KYWOMFVUDSHGQG-NKUHCKNESA-N |
| XLogP | 1.32 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|