C4H4F5NO3S — CID 20807111
N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide (PubChem CID 20807111) has the molecular formula C4H4F5NO3S and a molecular weight of 241.14 g/mol. Its IUPAC name is N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide.
| Compound Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 20807111 |
| Molecular Formula | C4H4F5NO3S |
| Molecular Weight | 241.14 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | N-(1,1,2,2,2-pentafluoroethylsulfonyl)acetamide |
| SMILES | CC(=O)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H4F5NO3S/c1-2(11)10-14(12,13)4(8,9)3(5,6)7/h1H3,(H,10,11) |
| InChIKey | OXGDDDNZWNHMBS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|