C8H6F3IrN2O- — CID 20807127
iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide (PubChem CID 20807127) has the molecular formula C8H6F3IrN2O- and a molecular weight of 395.36 g/mol. Its IUPAC name is iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide.
| Compound Name | iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
|---|---|
| PubChem CID | 20807127 |
| Molecular Formula | C8H6F3IrN2O- |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
| SMILES | O=C([N-]Cc1ccccn1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C8H7F3N2O.Ir/c9-8(10,11)7(14)13-5-6-3-1-2-4-12-6;/h1-4H,5H2,(H,13,14);/p-1 |
| InChIKey | SXJFWXUNPIFCCD-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |