C26H12F8IrN4-2 — CID 20807149
iridium;2-[3-(2,3,4,5,6-pentafluorophenyl)pyrazol-1-id-5-yl]pyridine;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 20807149) has the molecular formula C26H12F8IrN4-2 and a molecular weight of 724.61 g/mol. Its IUPAC name is iridium;2-[3-(2,3,4,5,6-pentafluorophenyl)pyrazol-1-id-5-yl]pyridine;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium;2-[3-(2,3,4,5,6-pentafluorophenyl)pyrazol-1-id-5-yl]pyridine;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 20807149 |
| Molecular Formula | C26H12F8IrN4-2 |
| Molecular Weight | 724.61 g/mol |
| Exact Mass | 725.06 |
| IUPAC Name | iridium;2-[3-(2,3,4,5,6-pentafluorophenyl)pyrazol-1-id-5-yl]pyridine;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | FC(F)(F)c1c[c-]c(-c2ccccn2)cc1.Fc1c(F)c(F)c(-c2cc(-c3ccccn3)[n-]n2)c(F)c1F.[Ir] |
| InChI | InChI=1S/C14H5F5N3.C12H7F3N.Ir/c15-10-9(11(16)13(18)14(19)12(10)17)8-5-7(21-22-8)6-3-1-2-4-20-6;13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;/h1-5H;1-4,6-8H;/q2*-1; |
| InChIKey | JCSUFVLMRUWFPW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 52.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|