C13H12F3IrN4O2- — CID 20807313
(Z)-4-hydroxypent-3-en-2-one;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine (PubChem CID 20807313) has the molecular formula C13H12F3IrN4O2- and a molecular weight of 505.48 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 20807313 |
| Molecular Formula | C13H12F3IrN4O2- |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
| SMILES | CC(=O)/C=C(/C)O.FC(F)(F)c1n[n-]c(-c2ccccn2)n1.[Ir] |
| InChI | InChI=1S/C8H4F3N4.C5H8O2.Ir/c9-8(10,11)7-13-6(14-15-7)5-3-1-2-4-12-5;1-4(6)3-5(2)7;/h1-4H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | LBSRGCCBLDZQSF-LWFKIUJUSA-N |
| XLogP | 2.55 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|