C20H15F3IrN4O-2 — CID 20807331
4,5-dimethyl-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-1,3-oxazole;iridium;2-phenylpyridine (PubChem CID 20807331) has the molecular formula C20H15F3IrN4O-2 and a molecular weight of 576.58 g/mol. Its IUPAC name is 4,5-dimethyl-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-1,3-oxazole;iridium;2-phenylpyridine.
| Compound Name | 4,5-dimethyl-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-1,3-oxazole;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 20807331 |
| Molecular Formula | C20H15F3IrN4O-2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 4,5-dimethyl-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]-1,3-oxazole;iridium;2-phenylpyridine |
| SMILES | Cc1nc(-c2cc(C(F)(F)F)n[n-]2)oc1C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C9H7F3N3O.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-4-5(2)16-8(13-4)6-3-7(15-14-6)9(10,11)12;/h1-6,8-9H;3H,1-2H3;/q2*-1; |
| InChIKey | LFMBAKGPWQTJRS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|