C22H13F7IrN4O-2 — CID 20807382
2-[3,4-bis(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium (PubChem CID 20807382) has the molecular formula C22H13F7IrN4O-2 and a molecular weight of 674.58 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium.
| Compound Name | 2-[3,4-bis(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium |
|---|---|
| PubChem CID | 20807382 |
| Molecular Formula | C22H13F7IrN4O-2 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 675.06 |
| IUPAC Name | 2-[3,4-bis(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium |
| SMILES | COc1ccnc(-c2[c-]cc(F)cc2)c1.FC(F)(F)c1n[n-]c(-c2ccccn2)c1C(F)(F)F.[Ir] |
| InChI | InChI=1S/C12H9FNO.C10H4F6N3.Ir/c1-15-11-6-7-14-12(8-11)9-2-4-10(13)5-3-9;11-9(12,13)6-7(5-3-1-2-4-17-5)18-19-8(6)10(14,15)16;/h2,4-8H,1H3;1-4H;/q2*-1; |
| InChIKey | TZBRPLFNENSTFD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 62.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|