C18H21BrO2 — CID 20807912
(4'aS,8'aS)-7'-(4-bromophenyl)spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] (PubChem CID 20807912) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is (4'aS,8'aS)-7'-(4-bromophenyl)spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene].
| Compound Name | (4'aS,8'aS)-7'-(4-bromophenyl)spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 20807912 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (4'aS,8'aS)-7'-(4-bromophenyl)spiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] |
| SMILES | Brc1ccc(C2=C[C@H]3CCC4(C[C@@H]3CC2)OCCO4)cc1 |
| InChI | InChI=1S/C18H21BrO2/c19-17-5-3-13(4-6-17)14-1-2-16-12-18(20-9-10-21-18)8-7-15(16)11-14/h3-6,11,15-16H,1-2,7-10,12H2/t15-,16+/m1/s1 |
| InChIKey | VGIKPTMRXUPEEG-CVEARBPZSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |