C21H34F2 — CID 20807965
(4aR,6R,8aR)-2-(2,2-difluoroethenyl)-6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20807965) has the molecular formula C21H34F2 and a molecular weight of 324.50 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-(2,2-difluoroethenyl)-6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-(2,2-difluoroethenyl)-6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20807965 |
| Molecular Formula | C21H34F2 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (4aR,6R,8aR)-2-(2,2-difluoroethenyl)-6-(4-propylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCC1CCC([C@@H]2CC[C@@H]3CC(C=C(F)F)CC[C@@H]3C2)CC1 |
| InChI | InChI=1S/C21H34F2/c1-2-3-15-4-7-17(8-5-15)19-11-10-18-12-16(13-21(22)23)6-9-20(18)14-19/h13,15-20H,2-12,14H2,1H3/t15?,16?,17?,18-,19-,20-/m1/s1 |
| InChIKey | JDVXMJLQWGMTBF-XWGZDTEXSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |