C18H22F2O2 — CID 20808469
(4'aS,8'aR)-3'-(3,5-difluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene] (PubChem CID 20808469) has the molecular formula C18H22F2O2 and a molecular weight of 308.37 g/mol. Its IUPAC name is (4'aS,8'aR)-3'-(3,5-difluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene].
| Compound Name | (4'aS,8'aR)-3'-(3,5-difluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 20808469 |
| Molecular Formula | C18H22F2O2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (4'aS,8'aR)-3'-(3,5-difluorophenyl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene] |
| SMILES | Fc1cc(F)cc(C2CC[C@@H]3CC4(CC[C@H]3C2)OCCO4)c1 |
| InChI | InChI=1S/C18H22F2O2/c19-16-8-15(9-17(20)10-16)12-1-2-14-11-18(21-5-6-22-18)4-3-13(14)7-12/h8-10,12-14H,1-7,11H2/t12?,13-,14+/m0/s1 |
| InChIKey | FRNLUZSBIOVRJT-KFTPUPIBSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |