C16H19BrO — CID 20808476
(4aS,8aR)-6-(4-bromophenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one (PubChem CID 20808476) has the molecular formula C16H19BrO and a molecular weight of 307.23 g/mol. Its IUPAC name is (4aS,8aR)-6-(4-bromophenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,8aR)-6-(4-bromophenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 20808476 |
| Molecular Formula | C16H19BrO |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (4aS,8aR)-6-(4-bromophenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-one |
| SMILES | O=C1CC[C@H]2CC(c3ccc(Br)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C16H19BrO/c17-15-6-3-11(4-7-15)12-1-2-14-10-16(18)8-5-13(14)9-12/h3-4,6-7,12-14H,1-2,5,8-10H2/t12?,13-,14+/m0/s1 |
| InChIKey | BMQJVJBOGMMRKJ-KFTPUPIBSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |