C23H30F2 — CID 20808608
2-[(6R,8aR)-6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 20808608) has the molecular formula C23H30F2 and a molecular weight of 344.49 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 20808608 |
| Molecular Formula | C23H30F2 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-[(6R,8aR)-6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc2c(c1)CCC(C1CCC3C[C@H](C=C(F)F)CC[C@@H]3C1)C2 |
| InChI | InChI=1S/C23H30F2/c1-15-2-4-19-13-21(8-6-17(19)10-15)22-9-7-18-11-16(12-23(24)25)3-5-20(18)14-22/h2,4,10,12,16,18,20-22H,3,5-9,11,13-14H2,1H3/t16-,18?,20-,21?,22?/m1/s1 |
| InChIKey | LXVZZEIBHYDWCP-UFXMDQLRSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |