C27H42O — CID 20808617
2-[(6R,8aR)-6-hexoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 20808617) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-hexoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-hexoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 20808617 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | 2-[(6R,8aR)-6-hexoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCCO[C@@H]1CC[C@@H]2CC(C3CCc4cc(C)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C27H42O/c1-3-4-5-6-15-28-27-14-13-25-18-24(11-12-26(25)19-27)23-10-9-21-16-20(2)7-8-22(21)17-23/h7-8,16,23-27H,3-6,9-15,17-19H2,1-2H3/t23?,24?,25-,26?,27-/m1/s1 |
| InChIKey | JLABTODIWUWNNR-OYYUVHKHSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|