C23H25F3O2 — CID 20808745
methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4,5-trifluoronaphthalene-2-carboxylate (PubChem CID 20808745) has the molecular formula C23H25F3O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4,5-trifluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4,5-trifluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20808745 |
| Molecular Formula | C23H25F3O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | methyl 6-[(4aS,8aR)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4,5-trifluoronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccc(C3CC[C@H]4CC(C)CC[C@@H]4C3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C23H25F3O2/c1-12-3-4-14-10-15(6-5-13(14)9-12)17-8-7-16-11-18(23(27)28-2)21(25)22(26)19(16)20(17)24/h7-8,11-15H,3-6,9-10H2,1-2H3/t12?,13-,14+,15?/m0/s1 |
| InChIKey | IGMBNVDGOYCGFQ-RAFNIBEQSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |