C14H18N4OS2 — CID 2080898
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)butanamide (PubChem CID 2080898) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)butanamide.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 2080898 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(2,6-dimethylphenyl)butanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSc1nnc(N)s1 |
| InChI | InChI=1S/C14H18N4OS2/c1-9-5-3-6-10(2)12(9)16-11(19)7-4-8-20-14-18-17-13(15)21-14/h3,5-6H,4,7-8H2,1-2H3,(H2,15,17)(H,16,19) |
| InChIKey | ADLYWCPWBZULCN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|