C18H25F — CID 20809252
(4aR,6R,8aR)-2-ethyl-6-(3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809252) has the molecular formula C18H25F and a molecular weight of 260.40 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-ethyl-6-(3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-ethyl-6-(3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809252 |
| Molecular Formula | C18H25F |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (4aR,6R,8aR)-2-ethyl-6-(3-fluorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3cccc(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C18H25F/c1-2-13-6-7-16-11-17(9-8-15(16)10-13)14-4-3-5-18(19)12-14/h3-5,12-13,15-17H,2,6-11H2,1H3/t13?,15-,16-,17-/m1/s1 |
| InChIKey | NIVODHWRXQUNRN-SDAGNLPFSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |