C22H29F3N2O3S — CID 20810241
tert-butyl N-[(2R,6R)-2-methyl-3-sulfanylidene-6,7,8,9-tetrahydro-4H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate (PubChem CID 20810241) has the molecular formula C22H29F3N2O3S and a molecular weight of 458.55 g/mol. Its IUPAC name is tert-butyl N-[(2R,6R)-2-methyl-3-sulfanylidene-6,7,8,9-tetrahydro-4H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate.
| Compound Name | tert-butyl N-[(2R,6R)-2-methyl-3-sulfanylidene-6,7,8,9-tetrahydro-4H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate |
|---|---|
| PubChem CID | 20810241 |
| Molecular Formula | C22H29F3N2O3S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | tert-butyl N-[(2R,6R)-2-methyl-3-sulfanylidene-6,7,8,9-tetrahydro-4H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate |
| SMILES | C[C@H]1Oc2cc3c(cc2NC1=S)[C@H](N(CCCC(F)(F)F)C(=O)OC(C)(C)C)CCC3 |
| InChI | InChI=1S/C22H29F3N2O3S/c1-13-19(31)26-16-12-15-14(11-18(16)29-13)7-5-8-17(15)27(10-6-9-22(23,24)25)20(28)30-21(2,3)4/h11-13,17H,5-10H2,1-4H3,(H,26,31)/t13-,17-/m1/s1 |
| InChIKey | YCUPLNPTDABEIL-CXAGYDPISA-N |
| XLogP | 6.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|