C22H30F3N3O3 — CID 20810252
tert-butyl N-[(2R,6S)-3-amino-2-methyl-6,7,8,9-tetrahydro-2H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate (PubChem CID 20810252) has the molecular formula C22H30F3N3O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is tert-butyl N-[(2R,6S)-3-amino-2-methyl-6,7,8,9-tetrahydro-2H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate.
| Compound Name | tert-butyl N-[(2R,6S)-3-amino-2-methyl-6,7,8,9-tetrahydro-2H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate |
|---|---|
| PubChem CID | 20810252 |
| Molecular Formula | C22H30F3N3O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | tert-butyl N-[(2R,6S)-3-amino-2-methyl-6,7,8,9-tetrahydro-2H-benzo[g][1,4]benzoxazin-6-yl]-N-(4,4,4-trifluorobutyl)carbamate |
| SMILES | C[C@H]1Oc2cc3c(cc2N=C1N)[C@@H](N(CCCC(F)(F)F)C(=O)OC(C)(C)C)CCC3 |
| InChI | InChI=1S/C22H30F3N3O3/c1-13-19(26)27-16-12-15-14(11-18(16)30-13)7-5-8-17(15)28(10-6-9-22(23,24)25)20(29)31-21(2,3)4/h11-13,17H,5-10H2,1-4H3,(H2,26,27)/t13-,17+/m1/s1 |
| InChIKey | RBKIDPVWTGLLJH-DYVFJYSZSA-N |
| XLogP | 5.41 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |