About 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane
5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane (PubChem CID 20810934) has the molecular formula C20H31F5O
and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane.
Molecular Properties
| Compound Name | 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane |
| PubChem CID | 20810934 |
| Molecular Formula | C20H31F5O |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane |
| SMILES | CC1CCC(C2CCC(C(F)(F)OC3CC(F)C(F)C(F)C3)CC2)CC1 |
| InChI | InChI=1S/C20H31F5O/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)20(24,25)26-16-10-17(21)19(23)18(22)11-16/h12-19H,2-11H2,1H3 |
| InChIKey | GKSJCFSYUZCVPD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The IUPAC name of 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane (CID 20810934) is 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane.
What is the SMILES notation for 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The canonical SMILES for 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane is CC1CCC(C2CCC(C(F)(F)OC3CC(F)C(F)C(F)C3)CC2)CC1.
What is the InChIKey of 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
The InChIKey is GKSJCFSYUZCVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31F5O/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)20(24,25)26-16-10-17(21)19(23)18(22)11-16/h12-19H,2-11H2,1H3.
What are the key properties of 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane?
5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane has a molecular weight of 382.46 g/mol, XLogP of 6.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[difluoro-[4-(4-methylcyclohexyl)cyclohexyl]methoxy]-1,2,3-trifluorocyclohexane is sourced from PubChem (CID 20810934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).