C7H10F6O2S — CID 20811120
2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)butane (PubChem CID 20811120) has the molecular formula C7H10F6O2S and a molecular weight of 272.21 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)butane.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)butane |
|---|---|
| PubChem CID | 20811120 |
| Molecular Formula | C7H10F6O2S |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)butane |
| SMILES | CCC(C)S(=O)(=O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O2S/c1-3-4(2)16(14,15)5(6(8,9)10)7(11,12)13/h4-5H,3H2,1-2H3 |
| InChIKey | QCCBEUIKMOKFJJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |