C23H17ClN2O6S3+2 — CID 20811247
2-[5-chloro-2-[(5-phenyl-2'-sulfospiro[1,3-benzothiazol-3-ium-3,1'-aziridin-1-ium]-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid (PubChem CID 20811247) has the molecular formula C23H17ClN2O6S3+2 and a molecular weight of 549.05 g/mol. Its IUPAC name is 2-[5-chloro-2-[(5-phenyl-2'-sulfospiro[1,3-benzothiazol-3-ium-3,1'-aziridin-1-ium]-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[(5-phenyl-2'-sulfospiro[1,3-benzothiazol-3-ium-3,1'-aziridin-1-ium]-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid |
|---|---|
| PubChem CID | 20811247 |
| Molecular Formula | C23H17ClN2O6S3+2 |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | 2-[5-chloro-2-[(5-phenyl-2'-sulfospiro[1,3-benzothiazol-3-ium-3,1'-aziridin-1-ium]-2-ylidene)methyl]furo[2,3-d][1,3]thiazol-3-ium-3-yl]acetic acid |
| SMILES | O=C(O)C[n+]1c(C=C2Sc3ccc(-c4ccccc4)cc3[N+]23CC3S(=O)(=O)O)sc2cc(Cl)oc21 |
| InChI | InChI=1S/C23H15ClN2O6S3/c24-18-9-17-23(32-18)25(11-22(27)28)19(33-17)10-20-26(12-21(26)35(29,30)31)15-8-14(6-7-16(15)34-20)13-4-2-1-3-5-13/h1-10,21H,11-12H2/p+2 |
| InChIKey | FDJRVMCPUKVSMT-UHFFFAOYSA-P |
| XLogP | 4.83 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|