C8H15N5O — CID 20811390
2-amino-6,7-dimethyl-2,3,5,6,7,8-hexahydro-1H-pteridin-4-one (PubChem CID 20811390) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-amino-6,7-dimethyl-2,3,5,6,7,8-hexahydro-1H-pteridin-4-one.
| Compound Name | 2-amino-6,7-dimethyl-2,3,5,6,7,8-hexahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 20811390 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-amino-6,7-dimethyl-2,3,5,6,7,8-hexahydro-1H-pteridin-4-one |
| SMILES | CC1NC2=C(NC1C)C(=O)NC(N)N2 |
| InChI | InChI=1S/C8H15N5O/c1-3-4(2)11-6-5(10-3)7(14)13-8(9)12-6/h3-4,8,10-12H,9H2,1-2H3,(H,13,14) |
| InChIKey | OHYBQKFBKZNYKP-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |