About 6-amino-1,3-diazinane-2,4-dione
6-amino-1,3-diazinane-2,4-dione (PubChem CID 20811425) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is 6-amino-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1,3-diazinane-2,4-dione |
| PubChem CID | 20811425 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 6-amino-1,3-diazinane-2,4-dione |
| SMILES | NC1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C4H7N3O2/c5-2-1-3(8)7-4(9)6-2/h2H,1,5H2,(H2,6,7,8,9) |
| InChIKey | NOJWUXXAWOQCOA-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,3-diazinane-2,4-dione?
The IUPAC name of 6-amino-1,3-diazinane-2,4-dione (CID 20811425) is 6-amino-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-amino-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-amino-1,3-diazinane-2,4-dione is NC1CC(=O)NC(=O)N1.
What is the InChIKey of 6-amino-1,3-diazinane-2,4-dione?
The InChIKey is NOJWUXXAWOQCOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2/c5-2-1-3(8)7-4(9)6-2/h2H,1,5H2,(H2,6,7,8,9).
What are the key properties of 6-amino-1,3-diazinane-2,4-dione?
6-amino-1,3-diazinane-2,4-dione has a molecular weight of 129.12 g/mol, XLogP of -1.50, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,3-diazinane-2,4-dione is sourced from PubChem (CID 20811425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).