2-(1H-1,2,4-triazol-5-yl)acetic acid

C4H5N3O2 — CID 20812034

IUPAC2-(1H-1,2,4-triazol-5-yl)acetic acid
SMILESO=C(O)Cc1ncn[nH]1
InChIInChI=1S/C4H5N3O2/c8-4(9)1-3-5-2-6-7-3/h2H,1H2,(H,8,9)(H,5,6,7)
InChIKeyBUOSAFNJURLEMX-UHFFFAOYSA-N
MW127.10 g/mol
LogP-0.57
Rot. Bonds2

About 2-(1H-1,2,4-triazol-5-yl)acetic acid

2-(1H-1,2,4-triazol-5-yl)acetic acid (PubChem CID 20812034) has the molecular formula C4H5N3O2 and a molecular weight of 127.10 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(1H-1,2,4-triazol-5-yl)acetic acid
PubChem CID20812034
Molecular FormulaC4H5N3O2
Molecular Weight127.10 g/mol
Exact Mass127.04
IUPAC Name2-(1H-1,2,4-triazol-5-yl)acetic acid
SMILESO=C(O)Cc1ncn[nH]1
InChIInChI=1S/C4H5N3O2/c8-4(9)1-3-5-2-6-7-3/h2H,1H2,(H,8,9)(H,5,6,7)
InChIKeyBUOSAFNJURLEMX-UHFFFAOYSA-N
XLogP-0.57
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.10
LogP ≤ 5-0.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(1H-1,2,4-triazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1H-1,2,4-triazol-5-yl)acetic acid?
The IUPAC name of 2-(1H-1,2,4-triazol-5-yl)acetic acid (CID 20812034) is 2-(1H-1,2,4-triazol-5-yl)acetic acid.
What is the SMILES notation for 2-(1H-1,2,4-triazol-5-yl)acetic acid?
The canonical SMILES for 2-(1H-1,2,4-triazol-5-yl)acetic acid is O=C(O)Cc1ncn[nH]1.
What is the InChIKey of 2-(1H-1,2,4-triazol-5-yl)acetic acid?
The InChIKey is BUOSAFNJURLEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c8-4(9)1-3-5-2-6-7-3/h2H,1H2,(H,8,9)(H,5,6,7).
What are the key properties of 2-(1H-1,2,4-triazol-5-yl)acetic acid?
2-(1H-1,2,4-triazol-5-yl)acetic acid has a molecular weight of 127.10 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazol-5-yl)acetic acid is sourced from PubChem (CID 20812034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).