C18H15F2N5 — CID 20812067
3-ethyl-5-fluoro-2-[[2-(3-fluorophenyl)imidazol-1-yl]methyl]imidazo[4,5-b]pyridine (PubChem CID 20812067) has the molecular formula C18H15F2N5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2-[[2-(3-fluorophenyl)imidazol-1-yl]methyl]imidazo[4,5-b]pyridine.
| Compound Name | 3-ethyl-5-fluoro-2-[[2-(3-fluorophenyl)imidazol-1-yl]methyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 20812067 |
| Molecular Formula | C18H15F2N5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-ethyl-5-fluoro-2-[[2-(3-fluorophenyl)imidazol-1-yl]methyl]imidazo[4,5-b]pyridine |
| SMILES | CCn1c(Cn2ccnc2-c2cccc(F)c2)nc2ccc(F)nc21 |
| InChI | InChI=1S/C18H15F2N5/c1-2-25-16(22-14-6-7-15(20)23-18(14)25)11-24-9-8-21-17(24)12-4-3-5-13(19)10-12/h3-10H,2,11H2,1H3 |
| InChIKey | RYAFNWMUEIAJAO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|