C20H27NO2 — CID 20812161
1-[6-[(4-acetylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone (PubChem CID 20812161) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-[6-[(4-acetylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone.
| Compound Name | 1-[6-[(4-acetylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 20812161 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-[6-[(4-acetylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-3-yl]ethanone |
| SMILES | CC(=O)c1ccc(CC2CCC3CNC(C(C)=O)CC3C2)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-13(22)17-6-3-15(4-7-17)9-16-5-8-18-12-21-20(14(2)23)11-19(18)10-16/h3-4,6-7,16,18-21H,5,8-12H2,1-2H3 |
| InChIKey | GVRLVOQJLSRELH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |