C16H19N3O3 — CID 20812169
(5aS,7S)-7-(1-azidopropan-2-yl)-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 20812169) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (5aS,7S)-7-(1-azidopropan-2-yl)-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | (5aS,7S)-7-(1-azidopropan-2-yl)-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 20812169 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (5aS,7S)-7-(1-azidopropan-2-yl)-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C1CC[C@H](C(C)CN=[N+]=[N-])C[C@@H]1O2 |
| InChI | InChI=1S/C16H19N3O3/c1-9(8-18-19-17)11-3-4-12-6-13-15(22-14(12)7-11)5-10(2)21-16(13)20/h5-6,9,11,14H,3-4,7-8H2,1-2H3/t9?,11-,14-/m0/s1 |
| InChIKey | APMXBNADBXQEEB-PSADTEFUSA-N |
| XLogP | 3.84 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|