C7H7N5O — CID 20813
6-(furan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 20813) has the molecular formula C7H7N5O and a molecular weight of 177.17 g/mol. Its IUPAC name is 6-(furan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(furan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20813 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 6-(furan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C7H7N5O/c8-6-10-5(11-7(9)12-6)4-2-1-3-13-4/h1-3H,(H4,8,9,10,11,12) |
| InChIKey | ZIXSZSGPTZTMBU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |