About CID 20813056
CID 20813056 (PubChem CID 20813056) has the molecular formula C8H6BN
and a molecular weight of 126.95 g/mol.
Molecular Properties
| Compound Name | CID 20813056 |
| PubChem CID | 20813056 |
| Molecular Formula | C8H6BN |
| Molecular Weight | 126.95 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | — |
| SMILES | [B]C1=Nc2ccccc2C1 |
| InChI | InChI=1S/C8H6BN/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2 |
| InChIKey | BKQFTEKSPGJWFM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.95 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20813056 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20813056?
The IUPAC name of CID 20813056 (CID 20813056) is not available.
What is the SMILES notation for CID 20813056?
The canonical SMILES for CID 20813056 is [B]C1=Nc2ccccc2C1.
What is the InChIKey of CID 20813056?
The InChIKey is BKQFTEKSPGJWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BN/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4H,5H2.
What are the key properties of CID 20813056?
CID 20813056 has a molecular weight of 126.95 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20813056 is sourced from PubChem (CID 20813056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).