C16H44O6Si6 — CID 20813318
2,2,4,4,6,6,8,8,10,10,12-undecamethyl-12-(2-methylbutyl)-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 20813318) has the molecular formula C16H44O6Si6 and a molecular weight of 501.04 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10,12-undecamethyl-12-(2-methylbutyl)-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10,12-undecamethyl-12-(2-methylbutyl)-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 20813318 |
| Molecular Formula | C16H44O6Si6 |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10,12-undecamethyl-12-(2-methylbutyl)-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | CCC(C)C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C16H44O6Si6/c1-14-16(2)15-28(13)21-26(9,10)19-24(5,6)17-23(3,4)18-25(7,8)20-27(11,12)22-28/h16H,14-15H2,1-13H3 |
| InChIKey | HXHKACZSUHTOSG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|