About (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole
(2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole (PubChem CID 20813927) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 20813927 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc(C)n1-c1ccc2c(c1)C[C@@H](C)N2 |
| InChI | InChI=1S/C15H18N2/c1-10-8-13-9-14(6-7-15(13)16-10)17-11(2)4-5-12(17)3/h4-7,9-10,16H,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | JGXWQBXWQPTABN-SNVBAGLBSA-N |
| XLogP | 3.45 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole?
The IUPAC name of (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole (CID 20813927) is (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole is Cc1ccc(C)n1-c1ccc2c(c1)C[C@@H](C)N2.
What is the InChIKey of (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole?
The InChIKey is JGXWQBXWQPTABN-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H18N2/c1-10-8-13-9-14(6-7-15(13)16-10)17-11(2)4-5-12(17)3/h4-7,9-10,16H,8H2,1-3H3/t10-/m1/s1.
What are the key properties of (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole?
(2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole has a molecular weight of 226.32 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-(2,5-dimethylpyrrol-1-yl)-2-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 20813927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).