C15H17N — CID 20814148
4-(3H-inden-1-ylmethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 20814148) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is 4-(3H-inden-1-ylmethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(3H-inden-1-ylmethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 20814148 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 4-(3H-inden-1-ylmethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(CC2=CCc3ccccc32)CCNC1 |
| InChI | InChI=1S/C15H17N/c1-2-4-15-13(3-1)5-6-14(15)11-12-7-9-16-10-8-12/h1-4,6-7,16H,5,8-11H2 |
| InChIKey | ZMNSGJYWAUZPIF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|