C21H27N5O2S — CID 20814305
4,5-dimethyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine (PubChem CID 20814305) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 4,5-dimethyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 20814305 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4,5-dimethyl-N-[6-methyl-7-(3-morpholin-4-ylpropoxy)quinazolin-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1cc2c(Nc3nc(C)c(C)s3)ncnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C21H27N5O2S/c1-14-11-17-18(12-19(14)28-8-4-5-26-6-9-27-10-7-26)22-13-23-20(17)25-21-24-15(2)16(3)29-21/h11-13H,4-10H2,1-3H3,(H,22,23,24,25) |
| InChIKey | HOAQYCNUOSDJRK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|