About 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene
1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene (PubChem CID 20814944) has the molecular formula C12H13F6O5PS
and a molecular weight of 414.26 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene.
Molecular Properties
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene |
| PubChem CID | 20814944 |
| Molecular Formula | C12H13F6O5PS |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc(CP(=O)(OCC(F)(F)F)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F6O5PS/c1-25(20,21)10-4-2-9(3-5-10)6-24(19,22-7-11(13,14)15)23-8-12(16,17)18/h2-5H,6-8H2,1H3 |
| InChIKey | HRFDVQOATUDINH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene?
The IUPAC name of 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene (CID 20814944) is 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene.
What is the SMILES notation for 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene?
The canonical SMILES for 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene is CS(=O)(=O)c1ccc(CP(=O)(OCC(F)(F)F)OCC(F)(F)F)cc1.
What is the InChIKey of 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene?
The InChIKey is HRFDVQOATUDINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F6O5PS/c1-25(20,21)10-4-2-9(3-5-10)6-24(19,22-7-11(13,14)15)23-8-12(16,17)18/h2-5H,6-8H2,1H3.
What are the key properties of 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene?
1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene has a molecular weight of 414.26 g/mol, XLogP of 3.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,2,2-trifluoroethoxy)phosphorylmethyl]-4-methylsulfonylbenzene is sourced from PubChem (CID 20814944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).