C28H25Cl2F3N4O2S — CID 20815224
1-(4-chloro-3-methylphenyl)-3-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]urea (PubChem CID 20815224) has the molecular formula C28H25Cl2F3N4O2S and a molecular weight of 609.50 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-3-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]urea.
| Compound Name | 1-(4-chloro-3-methylphenyl)-3-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]urea |
|---|---|
| PubChem CID | 20815224 |
| Molecular Formula | C28H25Cl2F3N4O2S |
| Molecular Weight | 609.50 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-3-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propyl]urea |
| SMILES | Cc1cc(NC(=O)NCCCn2c(-c3ccc(OC(F)(F)F)cc3)cs/c2=N\Cc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C28H25Cl2F3N4O2S/c1-18-15-22(9-12-24(18)30)36-26(38)34-13-2-14-37-25(20-5-10-23(11-6-20)39-28(31,32)33)17-40-27(37)35-16-19-3-7-21(29)8-4-19/h3-12,15,17H,2,13-14,16H2,1H3,(H2,34,36,38)/b35-27- |
| InChIKey | CEQRTVXILUSTCL-LSWMGQQCSA-N |
| XLogP | 8.04 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.50 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|