C26H31ClF3N5O2S — CID 20815268
2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 20815268) has the molecular formula C26H31ClF3N5O2S and a molecular weight of 570.08 g/mol. Its IUPAC name is 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 20815268 |
| Molecular Formula | C26H31ClF3N5O2S |
| Molecular Weight | 570.08 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | CN(C)CCNC(=O)CNCCCn1c(-c2ccc(OC(F)(F)F)cc2)cs/c1=N\Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H31ClF3N5O2S/c1-34(2)15-13-32-24(36)17-31-12-3-14-35-23(20-6-10-22(11-7-20)37-26(28,29)30)18-38-25(35)33-16-19-4-8-21(27)9-5-19/h4-11,18,31H,3,12-17H2,1-2H3,(H,32,36)/b33-25- |
| InChIKey | FMLMAZFQLOJPPN-IVQJCJPDSA-N |
| XLogP | 4.53 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.08 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|