C26H30ClF3N4O2S — CID 20815273
2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N,N-diethylacetamide (PubChem CID 20815273) has the molecular formula C26H30ClF3N4O2S and a molecular weight of 555.07 g/mol. Its IUPAC name is 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N,N-diethylacetamide.
| Compound Name | 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 20815273 |
| Molecular Formula | C26H30ClF3N4O2S |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-[3-[2-[(4-chlorophenyl)methylimino]-4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-3-yl]propylamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CNCCCn1c(-c2ccc(OC(F)(F)F)cc2)cs/c1=N\Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H30ClF3N4O2S/c1-3-33(4-2)24(35)17-31-14-5-15-34-23(20-8-12-22(13-9-20)36-26(28,29)30)18-37-25(34)32-16-19-6-10-21(27)11-7-19/h6-13,18,31H,3-5,14-17H2,1-2H3/b32-25- |
| InChIKey | BNEHLKXRDUTEDI-MKCFTUBBSA-N |
| XLogP | 5.72 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|