C21H21F2N3S — CID 20815396
3-[4-(4-fluorophenyl)-2-(4-fluorophenyl)imino-1,3-thiazol-3-yl]-N-prop-1-en-2-ylpropan-1-amine (PubChem CID 20815396) has the molecular formula C21H21F2N3S and a molecular weight of 385.48 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-2-(4-fluorophenyl)imino-1,3-thiazol-3-yl]-N-prop-1-en-2-ylpropan-1-amine.
| Compound Name | 3-[4-(4-fluorophenyl)-2-(4-fluorophenyl)imino-1,3-thiazol-3-yl]-N-prop-1-en-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 20815396 |
| Molecular Formula | C21H21F2N3S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-2-(4-fluorophenyl)imino-1,3-thiazol-3-yl]-N-prop-1-en-2-ylpropan-1-amine |
| SMILES | C=C(C)NCCCn1c(-c2ccc(F)cc2)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F2N3S/c1-15(2)24-12-3-13-26-20(16-4-6-17(22)7-5-16)14-27-21(26)25-19-10-8-18(23)9-11-19/h4-11,14,24H,1,3,12-13H2,2H3/b25-21- |
| InChIKey | ZVKJNPSBQIQHBA-DAFNUICNSA-N |
| XLogP | 5.24 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|