C22H21N5O2S — CID 20815410
3-[4-(1,3-benzodioxol-5-yl)-2-(4-imidazol-1-ylphenyl)imino-1,3-thiazol-3-yl]propan-1-amine (PubChem CID 20815410) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-2-(4-imidazol-1-ylphenyl)imino-1,3-thiazol-3-yl]propan-1-amine.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-2-(4-imidazol-1-ylphenyl)imino-1,3-thiazol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 20815410 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-2-(4-imidazol-1-ylphenyl)imino-1,3-thiazol-3-yl]propan-1-amine |
| SMILES | NCCCn1c(-c2ccc3c(c2)OCO3)cs/c1=N\c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c23-8-1-10-27-19(16-2-7-20-21(12-16)29-15-28-20)13-30-22(27)25-17-3-5-18(6-4-17)26-11-9-24-14-26/h2-7,9,11-14H,1,8,10,15,23H2/b25-22- |
| InChIKey | DEXNSBXIPUVPOR-LVWGJNHUSA-N |
| XLogP | 3.71 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|