About 6-tert-butyl-3,4-dihydro-2H-thiochromene
6-tert-butyl-3,4-dihydro-2H-thiochromene (PubChem CID 20815723) has the molecular formula C13H18S
and a molecular weight of 206.35 g/mol. Its IUPAC name is 6-tert-butyl-3,4-dihydro-2H-thiochromene.
Molecular Properties
| Compound Name | 6-tert-butyl-3,4-dihydro-2H-thiochromene |
| PubChem CID | 20815723 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-tert-butyl-3,4-dihydro-2H-thiochromene |
| SMILES | CC(C)(C)c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C13H18S/c1-13(2,3)11-6-7-12-10(9-11)5-4-8-14-12/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | ZOEJVCIGSQZDRF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-3,4-dihydro-2H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3,4-dihydro-2H-thiochromene?
The IUPAC name of 6-tert-butyl-3,4-dihydro-2H-thiochromene (CID 20815723) is 6-tert-butyl-3,4-dihydro-2H-thiochromene.
What is the SMILES notation for 6-tert-butyl-3,4-dihydro-2H-thiochromene?
The canonical SMILES for 6-tert-butyl-3,4-dihydro-2H-thiochromene is CC(C)(C)c1ccc2c(c1)CCCS2.
What is the InChIKey of 6-tert-butyl-3,4-dihydro-2H-thiochromene?
The InChIKey is ZOEJVCIGSQZDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18S/c1-13(2,3)11-6-7-12-10(9-11)5-4-8-14-12/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 6-tert-butyl-3,4-dihydro-2H-thiochromene?
6-tert-butyl-3,4-dihydro-2H-thiochromene has a molecular weight of 206.35 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3,4-dihydro-2H-thiochromene is sourced from PubChem (CID 20815723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).