C19H12N5+ — CID 20816065
2,11,22,23-tetraza-8-azoniaoctacyclo[11.9.1.11,8.02,6.03,21.016,23.018,22.011,24]tetracosa-3,5,7,9,12,14,16,18,20-nonaene (PubChem CID 20816065) has the molecular formula C19H12N5+ and a molecular weight of 310.34 g/mol. Its IUPAC name is 2,11,22,23-tetraza-8-azoniaoctacyclo[11.9.1.11,8.02,6.03,21.016,23.018,22.011,24]tetracosa-3,5,7,9,12,14,16,18,20-nonaene.
| Compound Name | 2,11,22,23-tetraza-8-azoniaoctacyclo[11.9.1.11,8.02,6.03,21.016,23.018,22.011,24]tetracosa-3,5,7,9,12,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 20816065 |
| Molecular Formula | C19H12N5+ |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2,11,22,23-tetraza-8-azoniaoctacyclo[11.9.1.11,8.02,6.03,21.016,23.018,22.011,24]tetracosa-3,5,7,9,12,14,16,18,20-nonaene |
| SMILES | C1=C[N+]2=Cc3ccc4n3C35C2N1C=c1ccc(n13)=Cc1ccc-4n15 |
| InChI | InChI=1S/C19H12N5/c1-2-14-10-20-7-8-21-11-15-4-6-17-16-5-3-13-9-12(1)22(14)19(18(20)21,23(13)16)24(15)17/h1-11,18H/q+1 |
| InChIKey | WPDJDLMWKNXUFE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 21.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_H(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|