C17H23N7+2 — CID 20816081
3,6,8,11,22-pentaza-1,18-diazoniapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),4,9,13,15,18-hexaene (PubChem CID 20816081) has the molecular formula C17H23N7+2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3,6,8,11,22-pentaza-1,18-diazoniapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),4,9,13,15,18-hexaene.
| Compound Name | 3,6,8,11,22-pentaza-1,18-diazoniapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),4,9,13,15,18-hexaene |
|---|---|
| PubChem CID | 20816081 |
| Molecular Formula | C17H23N7+2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3,6,8,11,22-pentaza-1,18-diazoniapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),4,9,13,15,18-hexaene |
| SMILES | C1=CN2CN1Cc1ccc([nH]1)C[N+]1=CC=[N+](CN3C=CN(C2)C3)C1 |
| InChI | InChI=1S/C17H22N7/c1-2-17-10-20-4-6-22(12-20)14-24-8-7-23(15-24)13-21-5-3-19(11-21)9-16(1)18-17/h1-8H,9-15H2/q+1/p+1 |
| InChIKey | QAGHSIFBSQOVEI-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 34.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|