C29H35N7+2 — CID 20816104
(17Z)-14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),3,5,8(29),9,13,15,17,19,21(27),24-undecaene (PubChem CID 20816104) has the molecular formula C29H35N7+2 and a molecular weight of 481.65 g/mol. Its IUPAC name is (17Z)-14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),3,5,8(29),9,13,15,17,19,21(27),24-undecaene.
| Compound Name | (17Z)-14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),3,5,8(29),9,13,15,17,19,21(27),24-undecaene |
|---|---|
| PubChem CID | 20816104 |
| Molecular Formula | C29H35N7+2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | (17Z)-14,20-diethyl-15,19-dimethyl-11,23,27,28,30-pentaza-1,8-diazoniahexacyclo[21.2.1.13,6.18,11.113,16.118,21]triaconta-1(26),3,5,8(29),9,13,15,17,19,21(27),24-undecaene |
| SMILES | CCC1=C(C)/C2=C/c3[nH]c(c(CC)c3C)Cn3cc[n+](c3)Cc3ccc([nH]3)C[n+]3ccn(c3)CC1=N2 |
| InChI | InChI=1S/C29H35N7/c1-5-24-20(3)26-13-27-21(4)25(6-2)29(32-27)17-36-12-10-34(19-36)15-23-8-7-22(30-23)14-33-9-11-35(18-33)16-28(24)31-26/h7-13,18-19,30-31H,5-6,14-17H2,1-4H3/q+2/b27-13- |
| InChIKey | QLJXTJNMKFRINU-WKIKZPBSSA-N |
| XLogP | 4.07 |
| TPSA | 61.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|