About 2,4,5,6-tetramethyloxan-3-one
2,4,5,6-tetramethyloxan-3-one (PubChem CID 20816372) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2,4,5,6-tetramethyloxan-3-one.
Molecular Properties
| Compound Name | 2,4,5,6-tetramethyloxan-3-one |
| PubChem CID | 20816372 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2,4,5,6-tetramethyloxan-3-one |
| SMILES | CC1OC(C)C(C)C(C)C1=O |
| InChI | InChI=1S/C9H16O2/c1-5-6(2)9(10)8(4)11-7(5)3/h5-8H,1-4H3 |
| InChIKey | XSHVPMXQBXOEBN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5,6-tetramethyloxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5,6-tetramethyloxan-3-one?
The IUPAC name of 2,4,5,6-tetramethyloxan-3-one (CID 20816372) is 2,4,5,6-tetramethyloxan-3-one.
What is the SMILES notation for 2,4,5,6-tetramethyloxan-3-one?
The canonical SMILES for 2,4,5,6-tetramethyloxan-3-one is CC1OC(C)C(C)C(C)C1=O.
What is the InChIKey of 2,4,5,6-tetramethyloxan-3-one?
The InChIKey is XSHVPMXQBXOEBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-5-6(2)9(10)8(4)11-7(5)3/h5-8H,1-4H3.
What are the key properties of 2,4,5,6-tetramethyloxan-3-one?
2,4,5,6-tetramethyloxan-3-one has a molecular weight of 156.22 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5,6-tetramethyloxan-3-one is sourced from PubChem (CID 20816372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).