C10H20O3 — CID 20816379
3,4-dimethoxy-2,5,6-trimethyloxane (PubChem CID 20816379) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5,6-trimethyloxane.
| Compound Name | 3,4-dimethoxy-2,5,6-trimethyloxane |
|---|---|
| PubChem CID | 20816379 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 3,4-dimethoxy-2,5,6-trimethyloxane |
| SMILES | COC1C(C)OC(C)C(C)C1OC |
| InChI | InChI=1S/C10H20O3/c1-6-7(2)13-8(3)10(12-5)9(6)11-4/h6-10H,1-5H3 |
| InChIKey | XYEQCCZCXJWYIM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |