C10H21NO — CID 20816429
N-ethyl-N,2,6-trimethyloxan-3-amine (PubChem CID 20816429) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is N-ethyl-N,2,6-trimethyloxan-3-amine.
| Compound Name | N-ethyl-N,2,6-trimethyloxan-3-amine |
|---|---|
| PubChem CID | 20816429 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-ethyl-N,2,6-trimethyloxan-3-amine |
| SMILES | CCN(C)C1CCC(C)OC1C |
| InChI | InChI=1S/C10H21NO/c1-5-11(4)10-7-6-8(2)12-9(10)3/h8-10H,5-7H2,1-4H3 |
| InChIKey | CYMPQCUHNXFAFX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |