C13H13F3N4O2S — CID 2081647
2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2081647) has the molecular formula C13H13F3N4O2S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2081647 |
| Molecular Formula | C13H13F3N4O2S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[(5-oxo-4-propyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(F)c(F)c2F)n[nH]c1=O |
| InChI | InChI=1S/C13H13F3N4O2S/c1-2-5-20-12(22)18-19-13(20)23-6-9(21)17-8-4-3-7(14)10(15)11(8)16/h3-4H,2,5-6H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | JMNSBGCVJVVCGG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|