C20H21F3O3S — CID 20816526
[3-(5,6,7,8-tetrahydronaphthalen-1-yl)phenyl] 4,4,4-trifluorobutane-1-sulfonate (PubChem CID 20816526) has the molecular formula C20H21F3O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is [3-(5,6,7,8-tetrahydronaphthalen-1-yl)phenyl] 4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | [3-(5,6,7,8-tetrahydronaphthalen-1-yl)phenyl] 4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 20816526 |
| Molecular Formula | C20H21F3O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [3-(5,6,7,8-tetrahydronaphthalen-1-yl)phenyl] 4,4,4-trifluorobutane-1-sulfonate |
| SMILES | O=S(=O)(CCCC(F)(F)F)Oc1cccc(-c2cccc3c2CCCC3)c1 |
| InChI | InChI=1S/C20H21F3O3S/c21-20(22,23)12-5-13-27(24,25)26-17-9-3-8-16(14-17)19-11-4-7-15-6-1-2-10-18(15)19/h3-4,7-9,11,14H,1-2,5-6,10,12-13H2 |
| InChIKey | RMEURFQHFXDRFP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|